C21H25N3O2 — CID 109089442
2-N-cycloheptyl-4-N-(2-methylphenyl)pyridine-2,4-dicarboxamide (PubChem CID 109089442) has the molecular formula C21H25N3O2 and a molecular weight of 351.45 g/mol. Its IUPAC name is 2-N-cycloheptyl-4-N-(2-methylphenyl)pyridine-2,4-dicarboxamide.
| Compound Name | 2-N-cycloheptyl-4-N-(2-methylphenyl)pyridine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 109089442 |
| Molecular Formula | C21H25N3O2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | 2-N-cycloheptyl-4-N-(2-methylphenyl)pyridine-2,4-dicarboxamide |
| SMILES | Cc1ccccc1NC(=O)c1ccnc(C(=O)NC2CCCCCC2)c1 |
| InChI | InChI=1S/C21H25N3O2/c1-15-8-6-7-11-18(15)24-20(25)16-12-13-22-19(14-16)21(26)23-17-9-4-2-3-5-10-17/h6-8,11-14,17H,2-5,9-10H2,1H3,(H,23,26)(H,24,25) |
| InChIKey | BLLGLXZWFUZIPI-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |