C19H20ClN3O2 — CID 109080961
4-N-(3-chloro-4-methylphenyl)-2-N-cyclopentylpyridine-2,4-dicarboxamide (PubChem CID 109080961) has the molecular formula C19H20ClN3O2 and a molecular weight of 357.84 g/mol. Its IUPAC name is 4-N-(3-chloro-4-methylphenyl)-2-N-cyclopentylpyridine-2,4-dicarboxamide.
| Compound Name | 4-N-(3-chloro-4-methylphenyl)-2-N-cyclopentylpyridine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 109080961 |
| Molecular Formula | C19H20ClN3O2 |
| Molecular Weight | 357.84 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | 4-N-(3-chloro-4-methylphenyl)-2-N-cyclopentylpyridine-2,4-dicarboxamide |
| SMILES | Cc1ccc(NC(=O)c2ccnc(C(=O)NC3CCCC3)c2)cc1Cl |
| InChI | InChI=1S/C19H20ClN3O2/c1-12-6-7-15(11-16(12)20)23-18(24)13-8-9-21-17(10-13)19(25)22-14-4-2-3-5-14/h6-11,14H,2-5H2,1H3,(H,22,25)(H,23,24) |
| InChIKey | OJNRUQPBYJFJGQ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.84 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |