C18H17ClFN3O2 — CID 109080795
2-N-(3-chloro-4-fluorophenyl)-4-N-cyclopentylpyridine-2,4-dicarboxamide (PubChem CID 109080795) has the molecular formula C18H17ClFN3O2 and a molecular weight of 361.80 g/mol. Its IUPAC name is 2-N-(3-chloro-4-fluorophenyl)-4-N-cyclopentylpyridine-2,4-dicarboxamide.
| Compound Name | 2-N-(3-chloro-4-fluorophenyl)-4-N-cyclopentylpyridine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 109080795 |
| Molecular Formula | C18H17ClFN3O2 |
| Molecular Weight | 361.80 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | 2-N-(3-chloro-4-fluorophenyl)-4-N-cyclopentylpyridine-2,4-dicarboxamide |
| SMILES | O=C(NC1CCCC1)c1ccnc(C(=O)Nc2ccc(F)c(Cl)c2)c1 |
| InChI | InChI=1S/C18H17ClFN3O2/c19-14-10-13(5-6-15(14)20)23-18(25)16-9-11(7-8-21-16)17(24)22-12-3-1-2-4-12/h5-10,12H,1-4H2,(H,22,24)(H,23,25) |
| InChIKey | UOUACCZCYGXEGB-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.80 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |