C20H22ClN3O2 — CID 109081597
4-N-(4-chloro-2-methylphenyl)-2-N-cyclohexylpyridine-2,4-dicarboxamide (PubChem CID 109081597) has the molecular formula C20H22ClN3O2 and a molecular weight of 371.87 g/mol. Its IUPAC name is 4-N-(4-chloro-2-methylphenyl)-2-N-cyclohexylpyridine-2,4-dicarboxamide.
| Compound Name | 4-N-(4-chloro-2-methylphenyl)-2-N-cyclohexylpyridine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 109081597 |
| Molecular Formula | C20H22ClN3O2 |
| Molecular Weight | 371.87 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | 4-N-(4-chloro-2-methylphenyl)-2-N-cyclohexylpyridine-2,4-dicarboxamide |
| SMILES | Cc1cc(Cl)ccc1NC(=O)c1ccnc(C(=O)NC2CCCCC2)c1 |
| InChI | InChI=1S/C20H22ClN3O2/c1-13-11-15(21)7-8-17(13)24-19(25)14-9-10-22-18(12-14)20(26)23-16-5-3-2-4-6-16/h7-12,16H,2-6H2,1H3,(H,23,26)(H,24,25) |
| InChIKey | OMAIPXVQAWCTPA-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.87 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |