C19H19Cl2N3O2 — CID 109081635
2-N-cyclohexyl-4-N-(2,4-dichlorophenyl)pyridine-2,4-dicarboxamide (PubChem CID 109081635) has the molecular formula C19H19Cl2N3O2 and a molecular weight of 392.29 g/mol. Its IUPAC name is 2-N-cyclohexyl-4-N-(2,4-dichlorophenyl)pyridine-2,4-dicarboxamide.
| Compound Name | 2-N-cyclohexyl-4-N-(2,4-dichlorophenyl)pyridine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 109081635 |
| Molecular Formula | C19H19Cl2N3O2 |
| Molecular Weight | 392.29 g/mol |
| Exact Mass | 391.09 |
| IUPAC Name | 2-N-cyclohexyl-4-N-(2,4-dichlorophenyl)pyridine-2,4-dicarboxamide |
| SMILES | O=C(Nc1ccc(Cl)cc1Cl)c1ccnc(C(=O)NC2CCCCC2)c1 |
| InChI | InChI=1S/C19H19Cl2N3O2/c20-13-6-7-16(15(21)11-13)24-18(25)12-8-9-22-17(10-12)19(26)23-14-4-2-1-3-5-14/h6-11,14H,1-5H2,(H,23,26)(H,24,25) |
| InChIKey | CCOLYNAXVDMNRF-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.29 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |