C19H18Cl2N2O2 — CID 109044538
1-N-cyclopentyl-4-N-(2,4-dichlorophenyl)benzene-1,4-dicarboxamide (PubChem CID 109044538) has the molecular formula C19H18Cl2N2O2 and a molecular weight of 377.27 g/mol. Its IUPAC name is 1-N-cyclopentyl-4-N-(2,4-dichlorophenyl)benzene-1,4-dicarboxamide.
| Compound Name | 1-N-cyclopentyl-4-N-(2,4-dichlorophenyl)benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 109044538 |
| Molecular Formula | C19H18Cl2N2O2 |
| Molecular Weight | 377.27 g/mol |
| Exact Mass | 376.07 |
| IUPAC Name | 1-N-cyclopentyl-4-N-(2,4-dichlorophenyl)benzene-1,4-dicarboxamide |
| SMILES | O=C(Nc1ccc(Cl)cc1Cl)c1ccc(C(=O)NC2CCCC2)cc1 |
| InChI | InChI=1S/C19H18Cl2N2O2/c20-14-9-10-17(16(21)11-14)23-19(25)13-7-5-12(6-8-13)18(24)22-15-3-1-2-4-15/h5-11,15H,1-4H2,(H,22,24)(H,23,25) |
| InChIKey | DKCVGHIMQIZZHR-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.27 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |