C19H19F2N3O2 — CID 109081485
4-N-cyclohexyl-2-N-(2,4-difluorophenyl)pyridine-2,4-dicarboxamide (PubChem CID 109081485) has the molecular formula C19H19F2N3O2 and a molecular weight of 359.38 g/mol. Its IUPAC name is 4-N-cyclohexyl-2-N-(2,4-difluorophenyl)pyridine-2,4-dicarboxamide.
| Compound Name | 4-N-cyclohexyl-2-N-(2,4-difluorophenyl)pyridine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 109081485 |
| Molecular Formula | C19H19F2N3O2 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | 4-N-cyclohexyl-2-N-(2,4-difluorophenyl)pyridine-2,4-dicarboxamide |
| SMILES | O=C(NC1CCCCC1)c1ccnc(C(=O)Nc2ccc(F)cc2F)c1 |
| InChI | InChI=1S/C19H19F2N3O2/c20-13-6-7-16(15(21)11-13)24-19(26)17-10-12(8-9-22-17)18(25)23-14-4-2-1-3-5-14/h6-11,14H,1-5H2,(H,23,25)(H,24,26) |
| InChIKey | LDZJZEHGTJCTRA-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |