C19H19F2N3O2 — CID 109095391
6-N-cyclohexyl-2-N-(2,4-difluorophenyl)pyridine-2,6-dicarboxamide (PubChem CID 109095391) has the molecular formula C19H19F2N3O2 and a molecular weight of 359.38 g/mol. Its IUPAC name is 6-N-cyclohexyl-2-N-(2,4-difluorophenyl)pyridine-2,6-dicarboxamide.
| Compound Name | 6-N-cyclohexyl-2-N-(2,4-difluorophenyl)pyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 109095391 |
| Molecular Formula | C19H19F2N3O2 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | 6-N-cyclohexyl-2-N-(2,4-difluorophenyl)pyridine-2,6-dicarboxamide |
| SMILES | O=C(Nc1ccc(F)cc1F)c1cccc(C(=O)NC2CCCCC2)n1 |
| InChI | InChI=1S/C19H19F2N3O2/c20-12-9-10-15(14(21)11-12)24-19(26)17-8-4-7-16(23-17)18(25)22-13-5-2-1-3-6-13/h4,7-11,13H,1-3,5-6H2,(H,22,25)(H,24,26) |
| InChIKey | RFEMTYBGAJQXLC-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |