C19H13F2N3O2 — CID 109100019
6-N-(2,4-difluorophenyl)-2-N-phenylpyridine-2,6-dicarboxamide (PubChem CID 109100019) has the molecular formula C19H13F2N3O2 and a molecular weight of 353.33 g/mol. Its IUPAC name is 6-N-(2,4-difluorophenyl)-2-N-phenylpyridine-2,6-dicarboxamide.
| Compound Name | 6-N-(2,4-difluorophenyl)-2-N-phenylpyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 109100019 |
| Molecular Formula | C19H13F2N3O2 |
| Molecular Weight | 353.33 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | 6-N-(2,4-difluorophenyl)-2-N-phenylpyridine-2,6-dicarboxamide |
| SMILES | O=C(Nc1ccccc1)c1cccc(C(=O)Nc2ccc(F)cc2F)n1 |
| InChI | InChI=1S/C19H13F2N3O2/c20-12-9-10-15(14(21)11-12)24-19(26)17-8-4-7-16(23-17)18(25)22-13-5-2-1-3-6-13/h1-11H,(H,22,25)(H,24,26) |
| InChIKey | ACZHCNPVMXLESO-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.33 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |