C19H11Cl2F2N3O2 — CID 3352552
2-N,6-N-bis(4-chloro-2-fluorophenyl)pyridine-2,6-dicarboxamide (PubChem CID 3352552) has the molecular formula C19H11Cl2F2N3O2 and a molecular weight of 422.22 g/mol. Its IUPAC name is 2-N,6-N-bis(4-chloro-2-fluorophenyl)pyridine-2,6-dicarboxamide.
| Compound Name | 2-N,6-N-bis(4-chloro-2-fluorophenyl)pyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 3352552 |
| Molecular Formula | C19H11Cl2F2N3O2 |
| Molecular Weight | 422.22 g/mol |
| Exact Mass | 421.02 |
| IUPAC Name | 2-N,6-N-bis(4-chloro-2-fluorophenyl)pyridine-2,6-dicarboxamide |
| SMILES | O=C(Nc1ccc(Cl)cc1F)c1cccc(C(=O)Nc2ccc(Cl)cc2F)n1 |
| InChI | InChI=1S/C19H11Cl2F2N3O2/c20-10-4-6-14(12(22)8-10)25-18(27)16-2-1-3-17(24-16)19(28)26-15-7-5-11(21)9-13(15)23/h1-9H,(H,25,27)(H,26,28) |
| InChIKey | KGRMLBMRVBTAHZ-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.22 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |