C18H13F2N3O — CID 109197129
5-anilino-N-(2,4-difluorophenyl)pyridine-2-carboxamide (PubChem CID 109197129) has the molecular formula C18H13F2N3O and a molecular weight of 325.32 g/mol. Its IUPAC name is 5-anilino-N-(2,4-difluorophenyl)pyridine-2-carboxamide.
| Compound Name | 5-anilino-N-(2,4-difluorophenyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109197129 |
| Molecular Formula | C18H13F2N3O |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | 5-anilino-N-(2,4-difluorophenyl)pyridine-2-carboxamide |
| SMILES | O=C(Nc1ccc(F)cc1F)c1ccc(Nc2ccccc2)cn1 |
| InChI | InChI=1S/C18H13F2N3O/c19-12-6-8-16(15(20)10-12)23-18(24)17-9-7-14(11-21-17)22-13-4-2-1-3-5-13/h1-11,22H,(H,23,24) |
| InChIKey | QZHAPUKSHLNMOY-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |