C18H12ClF2N3O — CID 109199191
N-(3-chlorophenyl)-5-(2,4-difluoroanilino)pyridine-2-carboxamide (PubChem CID 109199191) has the molecular formula C18H12ClF2N3O and a molecular weight of 359.76 g/mol. Its IUPAC name is N-(3-chlorophenyl)-5-(2,4-difluoroanilino)pyridine-2-carboxamide.
| Compound Name | N-(3-chlorophenyl)-5-(2,4-difluoroanilino)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109199191 |
| Molecular Formula | C18H12ClF2N3O |
| Molecular Weight | 359.76 g/mol |
| Exact Mass | 359.06 |
| IUPAC Name | N-(3-chlorophenyl)-5-(2,4-difluoroanilino)pyridine-2-carboxamide |
| SMILES | O=C(Nc1cccc(Cl)c1)c1ccc(Nc2ccc(F)cc2F)cn1 |
| InChI | InChI=1S/C18H12ClF2N3O/c19-11-2-1-3-13(8-11)24-18(25)17-7-5-14(10-22-17)23-16-6-4-12(20)9-15(16)21/h1-10,23H,(H,24,25) |
| InChIKey | RDYGQVKJNDMYLO-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.76 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |