C20H16ClF2N3O — CID 109193674
N-[2-(4-chlorophenyl)ethyl]-5-(2,4-difluoroanilino)pyridine-2-carboxamide (PubChem CID 109193674) has the molecular formula C20H16ClF2N3O and a molecular weight of 387.82 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)ethyl]-5-(2,4-difluoroanilino)pyridine-2-carboxamide.
| Compound Name | N-[2-(4-chlorophenyl)ethyl]-5-(2,4-difluoroanilino)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109193674 |
| Molecular Formula | C20H16ClF2N3O |
| Molecular Weight | 387.82 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | N-[2-(4-chlorophenyl)ethyl]-5-(2,4-difluoroanilino)pyridine-2-carboxamide |
| SMILES | O=C(NCCc1ccc(Cl)cc1)c1ccc(Nc2ccc(F)cc2F)cn1 |
| InChI | InChI=1S/C20H16ClF2N3O/c21-14-3-1-13(2-4-14)9-10-24-20(27)19-8-6-16(12-25-19)26-18-7-5-15(22)11-17(18)23/h1-8,11-12,26H,9-10H2,(H,24,27) |
| InChIKey | DWWFTTISKGBSBN-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.82 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |