C16H17F2N3O — CID 109195143
N-tert-butyl-5-(2,4-difluoroanilino)pyridine-2-carboxamide (PubChem CID 109195143) has the molecular formula C16H17F2N3O and a molecular weight of 305.33 g/mol. Its IUPAC name is N-tert-butyl-5-(2,4-difluoroanilino)pyridine-2-carboxamide.
| Compound Name | N-tert-butyl-5-(2,4-difluoroanilino)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109195143 |
| Molecular Formula | C16H17F2N3O |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | N-tert-butyl-5-(2,4-difluoroanilino)pyridine-2-carboxamide |
| SMILES | CC(C)(C)NC(=O)c1ccc(Nc2ccc(F)cc2F)cn1 |
| InChI | InChI=1S/C16H17F2N3O/c1-16(2,3)21-15(22)14-7-5-11(9-19-14)20-13-6-4-10(17)8-12(13)18/h4-9,20H,1-3H3,(H,21,22) |
| InChIKey | LDFPJTVNCKINQR-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |