C20H17F2N3O — CID 109198012
N-(2,4-difluorophenyl)-5-(2,4-dimethylanilino)pyridine-2-carboxamide (PubChem CID 109198012) has the molecular formula C20H17F2N3O and a molecular weight of 353.37 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-5-(2,4-dimethylanilino)pyridine-2-carboxamide.
| Compound Name | N-(2,4-difluorophenyl)-5-(2,4-dimethylanilino)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109198012 |
| Molecular Formula | C20H17F2N3O |
| Molecular Weight | 353.37 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | N-(2,4-difluorophenyl)-5-(2,4-dimethylanilino)pyridine-2-carboxamide |
| SMILES | Cc1ccc(Nc2ccc(C(=O)Nc3ccc(F)cc3F)nc2)c(C)c1 |
| InChI | InChI=1S/C20H17F2N3O/c1-12-3-6-17(13(2)9-12)24-15-5-8-19(23-11-15)20(26)25-18-7-4-14(21)10-16(18)22/h3-11,24H,1-2H3,(H,25,26) |
| InChIKey | HHQHVVKNMQMSMF-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.37 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |