C17H19N3O — CID 109179929
N-cyclopropyl-5-(2,4-dimethylanilino)pyridine-2-carboxamide (PubChem CID 109179929) has the molecular formula C17H19N3O and a molecular weight of 281.36 g/mol. Its IUPAC name is N-cyclopropyl-5-(2,4-dimethylanilino)pyridine-2-carboxamide.
| Compound Name | N-cyclopropyl-5-(2,4-dimethylanilino)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109179929 |
| Molecular Formula | C17H19N3O |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | N-cyclopropyl-5-(2,4-dimethylanilino)pyridine-2-carboxamide |
| SMILES | Cc1ccc(Nc2ccc(C(=O)NC3CC3)nc2)c(C)c1 |
| InChI | InChI=1S/C17H19N3O/c1-11-3-7-15(12(2)9-11)19-14-6-8-16(18-10-14)17(21)20-13-4-5-13/h3,6-10,13,19H,4-5H2,1-2H3,(H,20,21) |
| InChIKey | GLKQZHDXGNKYCD-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |