C22H25N3O4 — CID 109089488
methyl 2-[[2-(cycloheptylcarbamoyl)pyridine-4-carbonyl]amino]benzoate (PubChem CID 109089488) has the molecular formula C22H25N3O4 and a molecular weight of 395.46 g/mol. Its IUPAC name is methyl 2-[[2-(cycloheptylcarbamoyl)pyridine-4-carbonyl]amino]benzoate.
| Compound Name | methyl 2-[[2-(cycloheptylcarbamoyl)pyridine-4-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 109089488 |
| Molecular Formula | C22H25N3O4 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | methyl 2-[[2-(cycloheptylcarbamoyl)pyridine-4-carbonyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)c1ccnc(C(=O)NC2CCCCCC2)c1 |
| InChI | InChI=1S/C22H25N3O4/c1-29-22(28)17-10-6-7-11-18(17)25-20(26)15-12-13-23-19(14-15)21(27)24-16-8-4-2-3-5-9-16/h6-7,10-14,16H,2-5,8-9H2,1H3,(H,24,27)(H,25,26) |
| InChIKey | SOFUIOWQYQQLDR-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |