C20H21N3O4 — CID 109081318
methyl 2-[[2-(piperidine-1-carbonyl)pyridine-4-carbonyl]amino]benzoate (PubChem CID 109081318) has the molecular formula C20H21N3O4 and a molecular weight of 367.41 g/mol. Its IUPAC name is methyl 2-[[2-(piperidine-1-carbonyl)pyridine-4-carbonyl]amino]benzoate.
| Compound Name | methyl 2-[[2-(piperidine-1-carbonyl)pyridine-4-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 109081318 |
| Molecular Formula | C20H21N3O4 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | methyl 2-[[2-(piperidine-1-carbonyl)pyridine-4-carbonyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)c1ccnc(C(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C20H21N3O4/c1-27-20(26)15-7-3-4-8-16(15)22-18(24)14-9-10-21-17(13-14)19(25)23-11-5-2-6-12-23/h3-4,7-10,13H,2,5-6,11-12H2,1H3,(H,22,24) |
| InChIKey | GHHMPXNMLZNOOE-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |