C22H25N3O4 — CID 109090798
ethyl 2-[[2-(azepane-1-carbonyl)pyridine-4-carbonyl]amino]benzoate (PubChem CID 109090798) has the molecular formula C22H25N3O4 and a molecular weight of 395.46 g/mol. Its IUPAC name is ethyl 2-[[2-(azepane-1-carbonyl)pyridine-4-carbonyl]amino]benzoate.
| Compound Name | ethyl 2-[[2-(azepane-1-carbonyl)pyridine-4-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 109090798 |
| Molecular Formula | C22H25N3O4 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | ethyl 2-[[2-(azepane-1-carbonyl)pyridine-4-carbonyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1NC(=O)c1ccnc(C(=O)N2CCCCCC2)c1 |
| InChI | InChI=1S/C22H25N3O4/c1-2-29-22(28)17-9-5-6-10-18(17)24-20(26)16-11-12-23-19(15-16)21(27)25-13-7-3-4-8-14-25/h5-6,9-12,15H,2-4,7-8,13-14H2,1H3,(H,24,26) |
| InChIKey | DHUWSLPXTHEKIS-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |