C20H23N3O4 — CID 109089807
methyl 2-[[4-(pentylcarbamoyl)pyridine-2-carbonyl]amino]benzoate (PubChem CID 109089807) has the molecular formula C20H23N3O4 and a molecular weight of 369.42 g/mol. Its IUPAC name is methyl 2-[[4-(pentylcarbamoyl)pyridine-2-carbonyl]amino]benzoate.
| Compound Name | methyl 2-[[4-(pentylcarbamoyl)pyridine-2-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 109089807 |
| Molecular Formula | C20H23N3O4 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | methyl 2-[[4-(pentylcarbamoyl)pyridine-2-carbonyl]amino]benzoate |
| SMILES | CCCCCNC(=O)c1ccnc(C(=O)Nc2ccccc2C(=O)OC)c1 |
| InChI | InChI=1S/C20H23N3O4/c1-3-4-7-11-22-18(24)14-10-12-21-17(13-14)19(25)23-16-9-6-5-8-15(16)20(26)27-2/h5-6,8-10,12-13H,3-4,7,11H2,1-2H3,(H,22,24)(H,23,25) |
| InChIKey | YEUBHRNYTTWJHR-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|