C18H19F2N3O2 — CID 109089838
2-N-(2,6-difluorophenyl)-4-N-pentylpyridine-2,4-dicarboxamide (PubChem CID 109089838) has the molecular formula C18H19F2N3O2 and a molecular weight of 347.37 g/mol. Its IUPAC name is 2-N-(2,6-difluorophenyl)-4-N-pentylpyridine-2,4-dicarboxamide.
| Compound Name | 2-N-(2,6-difluorophenyl)-4-N-pentylpyridine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 109089838 |
| Molecular Formula | C18H19F2N3O2 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | 2-N-(2,6-difluorophenyl)-4-N-pentylpyridine-2,4-dicarboxamide |
| SMILES | CCCCCNC(=O)c1ccnc(C(=O)Nc2c(F)cccc2F)c1 |
| InChI | InChI=1S/C18H19F2N3O2/c1-2-3-4-9-22-17(24)12-8-10-21-15(11-12)18(25)23-16-13(19)6-5-7-14(16)20/h5-8,10-11H,2-4,9H2,1H3,(H,22,24)(H,23,25) |
| InChIKey | UZUXRVPEHASXHA-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|