C21H27N3O2 — CID 109089770
4-N-pentyl-2-N-(2,4,6-trimethylphenyl)pyridine-2,4-dicarboxamide (PubChem CID 109089770) has the molecular formula C21H27N3O2 and a molecular weight of 353.47 g/mol. Its IUPAC name is 4-N-pentyl-2-N-(2,4,6-trimethylphenyl)pyridine-2,4-dicarboxamide.
| Compound Name | 4-N-pentyl-2-N-(2,4,6-trimethylphenyl)pyridine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 109089770 |
| Molecular Formula | C21H27N3O2 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.21 |
| IUPAC Name | 4-N-pentyl-2-N-(2,4,6-trimethylphenyl)pyridine-2,4-dicarboxamide |
| SMILES | CCCCCNC(=O)c1ccnc(C(=O)Nc2c(C)cc(C)cc2C)c1 |
| InChI | InChI=1S/C21H27N3O2/c1-5-6-7-9-23-20(25)17-8-10-22-18(13-17)21(26)24-19-15(3)11-14(2)12-16(19)4/h8,10-13H,5-7,9H2,1-4H3,(H,23,25)(H,24,26) |
| InChIKey | VXCXBZAACCAJIR-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|