C19H22ClN3O2 — CID 109079488
2-N-butyl-4-N-(2-chloro-4,6-dimethylphenyl)pyridine-2,4-dicarboxamide (PubChem CID 109079488) has the molecular formula C19H22ClN3O2 and a molecular weight of 359.86 g/mol. Its IUPAC name is 2-N-butyl-4-N-(2-chloro-4,6-dimethylphenyl)pyridine-2,4-dicarboxamide.
| Compound Name | 2-N-butyl-4-N-(2-chloro-4,6-dimethylphenyl)pyridine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 109079488 |
| Molecular Formula | C19H22ClN3O2 |
| Molecular Weight | 359.86 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | 2-N-butyl-4-N-(2-chloro-4,6-dimethylphenyl)pyridine-2,4-dicarboxamide |
| SMILES | CCCCNC(=O)c1cc(C(=O)Nc2c(C)cc(C)cc2Cl)ccn1 |
| InChI | InChI=1S/C19H22ClN3O2/c1-4-5-7-22-19(25)16-11-14(6-8-21-16)18(24)23-17-13(3)9-12(2)10-15(17)20/h6,8-11H,4-5,7H2,1-3H3,(H,22,25)(H,23,24) |
| InChIKey | DGTZEMWYQXBSJN-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.86 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|