C20H24ClN3O2 — CID 109088529
2-N-[2-(4-chlorophenyl)ethyl]-4-N-pentylpyridine-2,4-dicarboxamide (PubChem CID 109088529) has the molecular formula C20H24ClN3O2 and a molecular weight of 373.88 g/mol. Its IUPAC name is 2-N-[2-(4-chlorophenyl)ethyl]-4-N-pentylpyridine-2,4-dicarboxamide.
| Compound Name | 2-N-[2-(4-chlorophenyl)ethyl]-4-N-pentylpyridine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 109088529 |
| Molecular Formula | C20H24ClN3O2 |
| Molecular Weight | 373.88 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | 2-N-[2-(4-chlorophenyl)ethyl]-4-N-pentylpyridine-2,4-dicarboxamide |
| SMILES | CCCCCNC(=O)c1ccnc(C(=O)NCCc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C20H24ClN3O2/c1-2-3-4-11-23-19(25)16-10-13-22-18(14-16)20(26)24-12-9-15-5-7-17(21)8-6-15/h5-8,10,13-14H,2-4,9,11-12H2,1H3,(H,23,25)(H,24,26) |
| InChIKey | AATVZAXCLBOWST-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.88 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|