C18H20FN3O2 — CID 109077658
2-N-[2-(4-fluorophenyl)ethyl]-4-N-propylpyridine-2,4-dicarboxamide (PubChem CID 109077658) has the molecular formula C18H20FN3O2 and a molecular weight of 329.38 g/mol. Its IUPAC name is 2-N-[2-(4-fluorophenyl)ethyl]-4-N-propylpyridine-2,4-dicarboxamide.
| Compound Name | 2-N-[2-(4-fluorophenyl)ethyl]-4-N-propylpyridine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 109077658 |
| Molecular Formula | C18H20FN3O2 |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.15 |
| IUPAC Name | 2-N-[2-(4-fluorophenyl)ethyl]-4-N-propylpyridine-2,4-dicarboxamide |
| SMILES | CCCNC(=O)c1ccnc(C(=O)NCCc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C18H20FN3O2/c1-2-9-21-17(23)14-8-11-20-16(12-14)18(24)22-10-7-13-3-5-15(19)6-4-13/h3-6,8,11-12H,2,7,9-10H2,1H3,(H,21,23)(H,22,24) |
| InChIKey | MXJYSZYFDZLKBF-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |