C21H17ClFN3O2 — CID 109088541
2-N-[2-(4-chlorophenyl)ethyl]-4-N-(4-fluorophenyl)pyridine-2,4-dicarboxamide (PubChem CID 109088541) has the molecular formula C21H17ClFN3O2 and a molecular weight of 397.84 g/mol. Its IUPAC name is 2-N-[2-(4-chlorophenyl)ethyl]-4-N-(4-fluorophenyl)pyridine-2,4-dicarboxamide.
| Compound Name | 2-N-[2-(4-chlorophenyl)ethyl]-4-N-(4-fluorophenyl)pyridine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 109088541 |
| Molecular Formula | C21H17ClFN3O2 |
| Molecular Weight | 397.84 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | 2-N-[2-(4-chlorophenyl)ethyl]-4-N-(4-fluorophenyl)pyridine-2,4-dicarboxamide |
| SMILES | O=C(Nc1ccc(F)cc1)c1ccnc(C(=O)NCCc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C21H17ClFN3O2/c22-16-3-1-14(2-4-16)9-11-25-21(28)19-13-15(10-12-24-19)20(27)26-18-7-5-17(23)6-8-18/h1-8,10,12-13H,9,11H2,(H,25,28)(H,26,27) |
| InChIKey | BAAXNGUBGBFEOG-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.84 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |