C21H17ClFN3O2 — CID 109098835
2-N-[2-(4-chlorophenyl)ethyl]-6-N-(4-fluorophenyl)pyridine-2,6-dicarboxamide (PubChem CID 109098835) has the molecular formula C21H17ClFN3O2 and a molecular weight of 397.84 g/mol. Its IUPAC name is 2-N-[2-(4-chlorophenyl)ethyl]-6-N-(4-fluorophenyl)pyridine-2,6-dicarboxamide.
| Compound Name | 2-N-[2-(4-chlorophenyl)ethyl]-6-N-(4-fluorophenyl)pyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 109098835 |
| Molecular Formula | C21H17ClFN3O2 |
| Molecular Weight | 397.84 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | 2-N-[2-(4-chlorophenyl)ethyl]-6-N-(4-fluorophenyl)pyridine-2,6-dicarboxamide |
| SMILES | O=C(NCCc1ccc(Cl)cc1)c1cccc(C(=O)Nc2ccc(F)cc2)n1 |
| InChI | InChI=1S/C21H17ClFN3O2/c22-15-6-4-14(5-7-15)12-13-24-20(27)18-2-1-3-19(26-18)21(28)25-17-10-8-16(23)9-11-17/h1-11H,12-13H2,(H,24,27)(H,25,28) |
| InChIKey | MJYGLPBMFBRRKT-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.84 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |