C14H15FN4O — CID 62237588
N-[2-(4-fluorophenyl)ethyl]-6-hydrazinylpyridine-2-carboxamide (PubChem CID 62237588) has the molecular formula C14H15FN4O and a molecular weight of 274.30 g/mol. Its IUPAC name is N-[2-(4-fluorophenyl)ethyl]-6-hydrazinylpyridine-2-carboxamide.
| Compound Name | N-[2-(4-fluorophenyl)ethyl]-6-hydrazinylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 62237588 |
| Molecular Formula | C14H15FN4O |
| Molecular Weight | 274.30 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | N-[2-(4-fluorophenyl)ethyl]-6-hydrazinylpyridine-2-carboxamide |
| SMILES | NNc1cccc(C(=O)NCCc2ccc(F)cc2)n1 |
| InChI | InChI=1S/C14H15FN4O/c15-11-6-4-10(5-7-11)8-9-17-14(20)12-2-1-3-13(18-12)19-16/h1-7H,8-9,16H2,(H,17,20)(H,18,19) |
| InChIKey | XUYNVJPYZMOZAM-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.30 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|