C16H16FN3O3 — CID 109095740
6-N-(4-fluorophenyl)-2-N-(2-methoxyethyl)pyridine-2,6-dicarboxamide (PubChem CID 109095740) has the molecular formula C16H16FN3O3 and a molecular weight of 317.32 g/mol. Its IUPAC name is 6-N-(4-fluorophenyl)-2-N-(2-methoxyethyl)pyridine-2,6-dicarboxamide.
| Compound Name | 6-N-(4-fluorophenyl)-2-N-(2-methoxyethyl)pyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 109095740 |
| Molecular Formula | C16H16FN3O3 |
| Molecular Weight | 317.32 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | 6-N-(4-fluorophenyl)-2-N-(2-methoxyethyl)pyridine-2,6-dicarboxamide |
| SMILES | COCCNC(=O)c1cccc(C(=O)Nc2ccc(F)cc2)n1 |
| InChI | InChI=1S/C16H16FN3O3/c1-23-10-9-18-15(21)13-3-2-4-14(20-13)16(22)19-12-7-5-11(17)6-8-12/h2-8H,9-10H2,1H3,(H,18,21)(H,19,22) |
| InChIKey | ZGDMJHASZFQNBZ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.32 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|