C17H16N4O3 — CID 109095810
6-N-(2-cyanophenyl)-2-N-(2-methoxyethyl)pyridine-2,6-dicarboxamide (PubChem CID 109095810) has the molecular formula C17H16N4O3 and a molecular weight of 324.34 g/mol. Its IUPAC name is 6-N-(2-cyanophenyl)-2-N-(2-methoxyethyl)pyridine-2,6-dicarboxamide.
| Compound Name | 6-N-(2-cyanophenyl)-2-N-(2-methoxyethyl)pyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 109095810 |
| Molecular Formula | C17H16N4O3 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | 6-N-(2-cyanophenyl)-2-N-(2-methoxyethyl)pyridine-2,6-dicarboxamide |
| SMILES | COCCNC(=O)c1cccc(C(=O)Nc2ccccc2C#N)n1 |
| InChI | InChI=1S/C17H16N4O3/c1-24-10-9-19-16(22)14-7-4-8-15(20-14)17(23)21-13-6-3-2-5-12(13)11-18/h2-8H,9-10H2,1H3,(H,19,22)(H,21,23) |
| InChIKey | WXPNOWLFNRDZSI-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 104.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|