C17H18ClN3O4 — CID 109095751
6-N-(5-chloro-2-methoxyphenyl)-2-N-(2-methoxyethyl)pyridine-2,6-dicarboxamide (PubChem CID 109095751) has the molecular formula C17H18ClN3O4 and a molecular weight of 363.80 g/mol. Its IUPAC name is 6-N-(5-chloro-2-methoxyphenyl)-2-N-(2-methoxyethyl)pyridine-2,6-dicarboxamide.
| Compound Name | 6-N-(5-chloro-2-methoxyphenyl)-2-N-(2-methoxyethyl)pyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 109095751 |
| Molecular Formula | C17H18ClN3O4 |
| Molecular Weight | 363.80 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | 6-N-(5-chloro-2-methoxyphenyl)-2-N-(2-methoxyethyl)pyridine-2,6-dicarboxamide |
| SMILES | COCCNC(=O)c1cccc(C(=O)Nc2cc(Cl)ccc2OC)n1 |
| InChI | InChI=1S/C17H18ClN3O4/c1-24-9-8-19-16(22)12-4-3-5-13(20-12)17(23)21-14-10-11(18)6-7-15(14)25-2/h3-7,10H,8-9H2,1-2H3,(H,19,22)(H,21,23) |
| InChIKey | CBUQMPFTHJDRQX-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.80 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|