C19H20ClN3O3 — CID 109095044
2-N-(5-chloro-2-methoxyphenyl)-6-N-cyclopentylpyridine-2,6-dicarboxamide (PubChem CID 109095044) has the molecular formula C19H20ClN3O3 and a molecular weight of 373.84 g/mol. Its IUPAC name is 2-N-(5-chloro-2-methoxyphenyl)-6-N-cyclopentylpyridine-2,6-dicarboxamide.
| Compound Name | 2-N-(5-chloro-2-methoxyphenyl)-6-N-cyclopentylpyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 109095044 |
| Molecular Formula | C19H20ClN3O3 |
| Molecular Weight | 373.84 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | 2-N-(5-chloro-2-methoxyphenyl)-6-N-cyclopentylpyridine-2,6-dicarboxamide |
| SMILES | COc1ccc(Cl)cc1NC(=O)c1cccc(C(=O)NC2CCCC2)n1 |
| InChI | InChI=1S/C19H20ClN3O3/c1-26-17-10-9-12(20)11-16(17)23-19(25)15-8-4-7-14(22-15)18(24)21-13-5-2-3-6-13/h4,7-11,13H,2-3,5-6H2,1H3,(H,21,24)(H,23,25) |
| InChIKey | XJAXTOZBWPRQOO-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.84 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |