C22H18N4O3 — CID 109100983
6-N-(2-cyanophenyl)-2-N-(4-ethoxyphenyl)pyridine-2,6-dicarboxamide (PubChem CID 109100983) has the molecular formula C22H18N4O3 and a molecular weight of 386.41 g/mol. Its IUPAC name is 6-N-(2-cyanophenyl)-2-N-(4-ethoxyphenyl)pyridine-2,6-dicarboxamide.
| Compound Name | 6-N-(2-cyanophenyl)-2-N-(4-ethoxyphenyl)pyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 109100983 |
| Molecular Formula | C22H18N4O3 |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | 6-N-(2-cyanophenyl)-2-N-(4-ethoxyphenyl)pyridine-2,6-dicarboxamide |
| SMILES | CCOc1ccc(NC(=O)c2cccc(C(=O)Nc3ccccc3C#N)n2)cc1 |
| InChI | InChI=1S/C22H18N4O3/c1-2-29-17-12-10-16(11-13-17)24-21(27)19-8-5-9-20(25-19)22(28)26-18-7-4-3-6-15(18)14-23/h3-13H,2H2,1H3,(H,24,27)(H,26,28) |
| InChIKey | OUWNGENXHHHQNL-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 104.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |