C22H16N4O3 — CID 109101022
2-N-(4-acetylphenyl)-6-N-(2-cyanophenyl)pyridine-2,6-dicarboxamide (PubChem CID 109101022) has the molecular formula C22H16N4O3 and a molecular weight of 384.40 g/mol. Its IUPAC name is 2-N-(4-acetylphenyl)-6-N-(2-cyanophenyl)pyridine-2,6-dicarboxamide.
| Compound Name | 2-N-(4-acetylphenyl)-6-N-(2-cyanophenyl)pyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 109101022 |
| Molecular Formula | C22H16N4O3 |
| Molecular Weight | 384.40 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | 2-N-(4-acetylphenyl)-6-N-(2-cyanophenyl)pyridine-2,6-dicarboxamide |
| SMILES | CC(=O)c1ccc(NC(=O)c2cccc(C(=O)Nc3ccccc3C#N)n2)cc1 |
| InChI | InChI=1S/C22H16N4O3/c1-14(27)15-9-11-17(12-10-15)24-21(28)19-7-4-8-20(25-19)22(29)26-18-6-3-2-5-16(18)13-23/h2-12H,1H3,(H,24,28)(H,26,29) |
| InChIKey | DLWMSMUHFAJQSQ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 111.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.40 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |