C21H16N4O3 — CID 109100968
2-N-(4-cyanophenyl)-6-N-(4-methoxyphenyl)pyridine-2,6-dicarboxamide (PubChem CID 109100968) has the molecular formula C21H16N4O3 and a molecular weight of 372.38 g/mol. Its IUPAC name is 2-N-(4-cyanophenyl)-6-N-(4-methoxyphenyl)pyridine-2,6-dicarboxamide.
| Compound Name | 2-N-(4-cyanophenyl)-6-N-(4-methoxyphenyl)pyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 109100968 |
| Molecular Formula | C21H16N4O3 |
| Molecular Weight | 372.38 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | 2-N-(4-cyanophenyl)-6-N-(4-methoxyphenyl)pyridine-2,6-dicarboxamide |
| SMILES | COc1ccc(NC(=O)c2cccc(C(=O)Nc3ccc(C#N)cc3)n2)cc1 |
| InChI | InChI=1S/C21H16N4O3/c1-28-17-11-9-16(10-12-17)24-21(27)19-4-2-3-18(25-19)20(26)23-15-7-5-14(13-22)6-8-15/h2-12H,1H3,(H,23,26)(H,24,27) |
| InChIKey | QISOQQRAURFNAO-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 104.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.38 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |