C21H24ClN3O2 — CID 109081545
4-N-[2-(4-chlorophenyl)ethyl]-2-N-cyclohexylpyridine-2,4-dicarboxamide (PubChem CID 109081545) has the molecular formula C21H24ClN3O2 and a molecular weight of 385.90 g/mol. Its IUPAC name is 4-N-[2-(4-chlorophenyl)ethyl]-2-N-cyclohexylpyridine-2,4-dicarboxamide.
| Compound Name | 4-N-[2-(4-chlorophenyl)ethyl]-2-N-cyclohexylpyridine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 109081545 |
| Molecular Formula | C21H24ClN3O2 |
| Molecular Weight | 385.90 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | 4-N-[2-(4-chlorophenyl)ethyl]-2-N-cyclohexylpyridine-2,4-dicarboxamide |
| SMILES | O=C(NCCc1ccc(Cl)cc1)c1ccnc(C(=O)NC2CCCCC2)c1 |
| InChI | InChI=1S/C21H24ClN3O2/c22-17-8-6-15(7-9-17)10-12-24-20(26)16-11-13-23-19(14-16)21(27)25-18-4-2-1-3-5-18/h6-9,11,13-14,18H,1-5,10,12H2,(H,24,26)(H,25,27) |
| InChIKey | ZDIAVYDBLWIENV-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.90 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |