C18H19F2N3O2 — CID 109090032
4-N-butyl-2-N-(2,6-difluorophenyl)-4-N-methylpyridine-2,4-dicarboxamide (PubChem CID 109090032) has the molecular formula C18H19F2N3O2 and a molecular weight of 347.37 g/mol. Its IUPAC name is 4-N-butyl-2-N-(2,6-difluorophenyl)-4-N-methylpyridine-2,4-dicarboxamide.
| Compound Name | 4-N-butyl-2-N-(2,6-difluorophenyl)-4-N-methylpyridine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 109090032 |
| Molecular Formula | C18H19F2N3O2 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | 4-N-butyl-2-N-(2,6-difluorophenyl)-4-N-methylpyridine-2,4-dicarboxamide |
| SMILES | CCCCN(C)C(=O)c1ccnc(C(=O)Nc2c(F)cccc2F)c1 |
| InChI | InChI=1S/C18H19F2N3O2/c1-3-4-10-23(2)18(25)12-8-9-21-15(11-12)17(24)22-16-13(19)6-5-7-14(16)20/h5-9,11H,3-4,10H2,1-2H3,(H,22,24) |
| InChIKey | YODFBVLOMNQQLF-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |