C22H29N3O2 — CID 109089968
4-N-butyl-2-N-(4-tert-butylphenyl)-4-N-methylpyridine-2,4-dicarboxamide (PubChem CID 109089968) has the molecular formula C22H29N3O2 and a molecular weight of 367.49 g/mol. Its IUPAC name is 4-N-butyl-2-N-(4-tert-butylphenyl)-4-N-methylpyridine-2,4-dicarboxamide.
| Compound Name | 4-N-butyl-2-N-(4-tert-butylphenyl)-4-N-methylpyridine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 109089968 |
| Molecular Formula | C22H29N3O2 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.23 |
| IUPAC Name | 4-N-butyl-2-N-(4-tert-butylphenyl)-4-N-methylpyridine-2,4-dicarboxamide |
| SMILES | CCCCN(C)C(=O)c1ccnc(C(=O)Nc2ccc(C(C)(C)C)cc2)c1 |
| InChI | InChI=1S/C22H29N3O2/c1-6-7-14-25(5)21(27)16-12-13-23-19(15-16)20(26)24-18-10-8-17(9-11-18)22(2,3)4/h8-13,15H,6-7,14H2,1-5H3,(H,24,26) |
| InChIKey | NYVXUYXBCIMHPK-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |