C21H22N2O4 — CID 120676239
cis-(1S,3R)-3-[(3-benzamido-4-methylbenzoyl)amino]cyclopentane-1-carboxylic acid (PubChem CID 120676239) has the molecular formula C21H22N2O4 and a molecular weight of 366.42 g/mol. Its IUPAC name is cis-(1S,3R)-3-[(3-benzamido-4-methylbenzoyl)amino]cyclopentane-1-carboxylic acid.
| Compound Name | cis-(1S,3R)-3-[(3-benzamido-4-methylbenzoyl)amino]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 120676239 |
| Molecular Formula | C21H22N2O4 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | cis-(1S,3R)-3-[(3-benzamido-4-methylbenzoyl)amino]cyclopentane-1-carboxylic acid |
| SMILES | Cc1ccc(C(=O)N[C@@H]2CC[C@H](C(=O)O)C2)cc1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C21H22N2O4/c1-13-7-8-15(20(25)22-17-10-9-16(11-17)21(26)27)12-18(13)23-19(24)14-5-3-2-4-6-14/h2-8,12,16-17H,9-11H2,1H3,(H,22,25)(H,23,24)(H,26,27)/t16-,17+/m0/s1 |
| InChIKey | RQNVHGKOIOCFBS-DLBZAZTESA-N |
| XLogP | 3.23 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |