C25H28N2O2 — CID 78862723
N-(2-adamantyl)-3-benzamido-4-methylbenzamide (PubChem CID 78862723) has the molecular formula C25H28N2O2 and a molecular weight of 388.51 g/mol. Its IUPAC name is N-(2-adamantyl)-3-benzamido-4-methylbenzamide.
| Compound Name | N-(2-adamantyl)-3-benzamido-4-methylbenzamide |
|---|---|
| PubChem CID | 78862723 |
| Molecular Formula | C25H28N2O2 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | N-(2-adamantyl)-3-benzamido-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NC2C3CC4CC(C3)CC2C4)cc1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C25H28N2O2/c1-15-7-8-19(14-22(15)26-24(28)18-5-3-2-4-6-18)25(29)27-23-20-10-16-9-17(12-20)13-21(23)11-16/h2-8,14,16-17,20-21,23H,9-13H2,1H3,(H,26,28)(H,27,29) |
| InChIKey | VXEPMWBJOBUGMA-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |