C22H23FN2O4 — CID 119230189
4-[[3-[(2-fluorobenzoyl)amino]-4-methylbenzoyl]amino]cyclohexane-1-carboxylic acid (PubChem CID 119230189) has the molecular formula C22H23FN2O4 and a molecular weight of 398.43 g/mol. Its IUPAC name is 4-[[3-[(2-fluorobenzoyl)amino]-4-methylbenzoyl]amino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[[3-[(2-fluorobenzoyl)amino]-4-methylbenzoyl]amino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 119230189 |
| Molecular Formula | C22H23FN2O4 |
| Molecular Weight | 398.43 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | 4-[[3-[(2-fluorobenzoyl)amino]-4-methylbenzoyl]amino]cyclohexane-1-carboxylic acid |
| SMILES | Cc1ccc(C(=O)NC2CCC(C(=O)O)CC2)cc1NC(=O)c1ccccc1F |
| InChI | InChI=1S/C22H23FN2O4/c1-13-6-7-15(20(26)24-16-10-8-14(9-11-16)22(28)29)12-19(13)25-21(27)17-4-2-3-5-18(17)23/h2-7,12,14,16H,8-11H2,1H3,(H,24,26)(H,25,27)(H,28,29) |
| InChIKey | PNZLFVXXOFGKRA-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.43 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |