C21H21FN2O4 — CID 119203367
2-[cyclopropyl-[3-[(2-fluorobenzoyl)amino]-4-methylbenzoyl]amino]propanoic acid (PubChem CID 119203367) has the molecular formula C21H21FN2O4 and a molecular weight of 384.41 g/mol. Its IUPAC name is 2-[cyclopropyl-[3-[(2-fluorobenzoyl)amino]-4-methylbenzoyl]amino]propanoic acid.
| Compound Name | 2-[cyclopropyl-[3-[(2-fluorobenzoyl)amino]-4-methylbenzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 119203367 |
| Molecular Formula | C21H21FN2O4 |
| Molecular Weight | 384.41 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | 2-[cyclopropyl-[3-[(2-fluorobenzoyl)amino]-4-methylbenzoyl]amino]propanoic acid |
| SMILES | Cc1ccc(C(=O)N(C2CC2)C(C)C(=O)O)cc1NC(=O)c1ccccc1F |
| InChI | InChI=1S/C21H21FN2O4/c1-12-7-8-14(20(26)24(15-9-10-15)13(2)21(27)28)11-18(12)23-19(25)16-5-3-4-6-17(16)22/h3-8,11,13,15H,9-10H2,1-2H3,(H,23,25)(H,27,28) |
| InChIKey | COCWERGYJYXSTO-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.41 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |