C20H22FN3O3 — CID 120944964
3-[(2-fluorobenzoyl)amino]-N-[(4-hydroxypyrrolidin-3-yl)methyl]-4-methylbenzamide (PubChem CID 120944964) has the molecular formula C20H22FN3O3 and a molecular weight of 371.41 g/mol. Its IUPAC name is 3-[(2-fluorobenzoyl)amino]-N-[(4-hydroxypyrrolidin-3-yl)methyl]-4-methylbenzamide.
| Compound Name | 3-[(2-fluorobenzoyl)amino]-N-[(4-hydroxypyrrolidin-3-yl)methyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 120944964 |
| Molecular Formula | C20H22FN3O3 |
| Molecular Weight | 371.41 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | 3-[(2-fluorobenzoyl)amino]-N-[(4-hydroxypyrrolidin-3-yl)methyl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NCC2CNCC2O)cc1NC(=O)c1ccccc1F |
| InChI | InChI=1S/C20H22FN3O3/c1-12-6-7-13(19(26)23-10-14-9-22-11-18(14)25)8-17(12)24-20(27)15-4-2-3-5-16(15)21/h2-8,14,18,22,25H,9-11H2,1H3,(H,23,26)(H,24,27) |
| InChIKey | SPXGCBOSWANCOB-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.41 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |