C20H18FN3O4S — CID 55957887
N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-3-[(2-fluorobenzoyl)amino]-4-methylbenzamide (PubChem CID 55957887) has the molecular formula C20H18FN3O4S and a molecular weight of 415.45 g/mol. Its IUPAC name is N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-3-[(2-fluorobenzoyl)amino]-4-methylbenzamide.
| Compound Name | N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-3-[(2-fluorobenzoyl)amino]-4-methylbenzamide |
|---|---|
| PubChem CID | 55957887 |
| Molecular Formula | C20H18FN3O4S |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-3-[(2-fluorobenzoyl)amino]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NCCN2C(=O)CSC2=O)cc1NC(=O)c1ccccc1F |
| InChI | InChI=1S/C20H18FN3O4S/c1-12-6-7-13(18(26)22-8-9-24-17(25)11-29-20(24)28)10-16(12)23-19(27)14-4-2-3-5-15(14)21/h2-7,10H,8-9,11H2,1H3,(H,22,26)(H,23,27) |
| InChIKey | XQMGBMZRTIIPMG-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|