C13H11F2N3O4S — CID 108522144
N'-(2,6-difluorophenyl)-N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]oxamide (PubChem CID 108522144) has the molecular formula C13H11F2N3O4S and a molecular weight of 343.31 g/mol. Its IUPAC name is N'-(2,6-difluorophenyl)-N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]oxamide.
| Compound Name | N'-(2,6-difluorophenyl)-N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]oxamide |
|---|---|
| PubChem CID | 108522144 |
| Molecular Formula | C13H11F2N3O4S |
| Molecular Weight | 343.31 g/mol |
| Exact Mass | 343.04 |
| IUPAC Name | N'-(2,6-difluorophenyl)-N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]oxamide |
| SMILES | O=C(NCCN1C(=O)CSC1=O)C(=O)Nc1c(F)cccc1F |
| InChI | InChI=1S/C13H11F2N3O4S/c14-7-2-1-3-8(15)10(7)17-12(21)11(20)16-4-5-18-9(19)6-23-13(18)22/h1-3H,4-6H2,(H,16,20)(H,17,21) |
| InChIKey | WVXKKYWUEDHXIF-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.31 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|