C15H15N3O6S — CID 108528193
methyl 4-[[2-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethylamino]-2-oxoacetyl]amino]benzoate (PubChem CID 108528193) has the molecular formula C15H15N3O6S and a molecular weight of 365.37 g/mol. Its IUPAC name is methyl 4-[[2-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethylamino]-2-oxoacetyl]amino]benzoate.
| Compound Name | methyl 4-[[2-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethylamino]-2-oxoacetyl]amino]benzoate |
|---|---|
| PubChem CID | 108528193 |
| Molecular Formula | C15H15N3O6S |
| Molecular Weight | 365.37 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | methyl 4-[[2-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethylamino]-2-oxoacetyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)C(=O)NCCN2C(=O)CSC2=O)cc1 |
| InChI | InChI=1S/C15H15N3O6S/c1-24-14(22)9-2-4-10(5-3-9)17-13(21)12(20)16-6-7-18-11(19)8-25-15(18)23/h2-5H,6-8H2,1H3,(H,16,20)(H,17,21) |
| InChIKey | ISPJQMXSJPISHR-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.37 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|