C13H12FN3O4S — CID 108512666
N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-N'-(4-fluorophenyl)oxamide (PubChem CID 108512666) has the molecular formula C13H12FN3O4S and a molecular weight of 325.32 g/mol. Its IUPAC name is N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-N'-(4-fluorophenyl)oxamide.
| Compound Name | N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-N'-(4-fluorophenyl)oxamide |
|---|---|
| PubChem CID | 108512666 |
| Molecular Formula | C13H12FN3O4S |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 325.05 |
| IUPAC Name | N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-N'-(4-fluorophenyl)oxamide |
| SMILES | O=C(NCCN1C(=O)CSC1=O)C(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C13H12FN3O4S/c14-8-1-3-9(4-2-8)16-12(20)11(19)15-5-6-17-10(18)7-22-13(17)21/h1-4H,5-7H2,(H,15,19)(H,16,20) |
| InChIKey | RYVGSEQBMYGFDK-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|