C14H14ClN3O4S — CID 108507812
N'-[(4-chlorophenyl)methyl]-N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]oxamide (PubChem CID 108507812) has the molecular formula C14H14ClN3O4S and a molecular weight of 355.80 g/mol. Its IUPAC name is N'-[(4-chlorophenyl)methyl]-N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]oxamide.
| Compound Name | N'-[(4-chlorophenyl)methyl]-N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]oxamide |
|---|---|
| PubChem CID | 108507812 |
| Molecular Formula | C14H14ClN3O4S |
| Molecular Weight | 355.80 g/mol |
| Exact Mass | 355.04 |
| IUPAC Name | N'-[(4-chlorophenyl)methyl]-N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]oxamide |
| SMILES | O=C(NCCN1C(=O)CSC1=O)C(=O)NCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H14ClN3O4S/c15-10-3-1-9(2-4-10)7-17-13(21)12(20)16-5-6-18-11(19)8-23-14(18)22/h1-4H,5-8H2,(H,16,20)(H,17,21) |
| InChIKey | QBVZQWUKWNOIGV-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.80 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|