C10H9ClN2O4S — CID 103622962
5-chloro-N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]furan-2-carboxamide (PubChem CID 103622962) has the molecular formula C10H9ClN2O4S and a molecular weight of 288.71 g/mol. Its IUPAC name is 5-chloro-N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]furan-2-carboxamide.
| Compound Name | 5-chloro-N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 103622962 |
| Molecular Formula | C10H9ClN2O4S |
| Molecular Weight | 288.71 g/mol |
| Exact Mass | 288.00 |
| IUPAC Name | 5-chloro-N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]furan-2-carboxamide |
| SMILES | O=C(NCCN1C(=O)CSC1=O)c1ccc(Cl)o1 |
| InChI | InChI=1S/C10H9ClN2O4S/c11-7-2-1-6(17-7)9(15)12-3-4-13-8(14)5-18-10(13)16/h1-2H,3-5H2,(H,12,15) |
| InChIKey | IMKDPQZTMLKFJX-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.71 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|