C14H14ClN3O3S — CID 108908585
1-[(E)-2-(4-chlorophenyl)ethenyl]-3-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]urea (PubChem CID 108908585) has the molecular formula C14H14ClN3O3S and a molecular weight of 339.80 g/mol. Its IUPAC name is 1-[(E)-2-(4-chlorophenyl)ethenyl]-3-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]urea.
| Compound Name | 1-[(E)-2-(4-chlorophenyl)ethenyl]-3-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]urea |
|---|---|
| PubChem CID | 108908585 |
| Molecular Formula | C14H14ClN3O3S |
| Molecular Weight | 339.80 g/mol |
| Exact Mass | 339.04 |
| IUPAC Name | 1-[(E)-2-(4-chlorophenyl)ethenyl]-3-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]urea |
| SMILES | O=C(N/C=C/c1ccc(Cl)cc1)NCCN1C(=O)CSC1=O |
| InChI | InChI=1S/C14H14ClN3O3S/c15-11-3-1-10(2-4-11)5-6-16-13(20)17-7-8-18-12(19)9-22-14(18)21/h1-6H,7-9H2,(H2,16,17,20)/b6-5+ |
| InChIKey | UXWBFURZUIYDSX-AATRIKPKSA-N |
| XLogP | 2.31 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.80 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|